C16H22ClFN2O3 — CID 111521496
N'-(4-chloro-2-fluorophenyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]oxamide (PubChem CID 111521496) has the molecular formula C16H22ClFN2O3 and a molecular weight of 344.81 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorophenyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]oxamide.
| Compound Name | N'-(4-chloro-2-fluorophenyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]oxamide |
|---|---|
| PubChem CID | 111521496 |
| Molecular Formula | C16H22ClFN2O3 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N'-(4-chloro-2-fluorophenyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]oxamide |
| SMILES | CC(C)CC(CCO)CNC(=O)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H22ClFN2O3/c1-10(2)7-11(5-6-21)9-19-15(22)16(23)20-14-4-3-12(17)8-13(14)18/h3-4,8,10-11,21H,5-7,9H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | PPZXWZAHCGQHLJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|