C15H20Cl2FNO2 — CID 111662542
2,4-dichloro-5-fluoro-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide (PubChem CID 111662542) has the molecular formula C15H20Cl2FNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide |
|---|---|
| PubChem CID | 111662542 |
| Molecular Formula | C15H20Cl2FNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide |
| SMILES | CC(C)CC(CCO)CNC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2FNO2/c1-9(2)5-10(3-4-20)8-19-15(21)11-6-14(18)13(17)7-12(11)16/h6-7,9-10,20H,3-5,8H2,1-2H3,(H,19,21) |
| InChIKey | ZAAINKXFURBXGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|