C15H22ClFN2O2 — CID 111521056
1-(5-chloro-2-fluorophenyl)-3-[2-(2-hydroxyethyl)-4-methylpentyl]urea (PubChem CID 111521056) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-3-[2-(2-hydroxyethyl)-4-methylpentyl]urea.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-3-[2-(2-hydroxyethyl)-4-methylpentyl]urea |
|---|---|
| PubChem CID | 111521056 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-3-[2-(2-hydroxyethyl)-4-methylpentyl]urea |
| SMILES | CC(C)CC(CCO)CNC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H22ClFN2O2/c1-10(2)7-11(5-6-20)9-18-15(21)19-14-8-12(16)3-4-13(14)17/h3-4,8,10-11,20H,5-7,9H2,1-2H3,(H2,18,19,21) |
| InChIKey | HILFCJWCJCERDS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |