C15H22FNO3 — CID 111860779
5-fluoro-2-hydroxy-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide (PubChem CID 111860779) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide.
| Compound Name | 5-fluoro-2-hydroxy-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide |
|---|---|
| PubChem CID | 111860779 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-fluoro-2-hydroxy-N-[2-(2-hydroxyethyl)-4-methylpentyl]benzamide |
| SMILES | CC(C)CC(CCO)CNC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C15H22FNO3/c1-10(2)7-11(5-6-18)9-17-15(20)13-8-12(16)3-4-14(13)19/h3-4,8,10-11,18-19H,5-7,9H2,1-2H3,(H,17,20) |
| InChIKey | VSAFTECTUPCVLS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |