C12H14ClFN2O2 — CID 44999475
N-butyl-N'-(4-chloro-2-fluorophenyl)oxamide (PubChem CID 44999475) has the molecular formula C12H14ClFN2O2 and a molecular weight of 272.71 g/mol. Its IUPAC name is N-butyl-N'-(4-chloro-2-fluorophenyl)oxamide.
| Compound Name | N-butyl-N'-(4-chloro-2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 44999475 |
| Molecular Formula | C12H14ClFN2O2 |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-butyl-N'-(4-chloro-2-fluorophenyl)oxamide |
| SMILES | CCCCNC(=O)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H14ClFN2O2/c1-2-3-6-15-11(17)12(18)16-10-5-4-8(13)7-9(10)14/h4-5,7H,2-3,6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | FWDCEKHXPBIRPI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|