C13H18ClFN2O — CID 60721606
N-butyl-2-(4-chloro-2-fluoroanilino)propanamide (PubChem CID 60721606) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is N-butyl-2-(4-chloro-2-fluoroanilino)propanamide.
| Compound Name | N-butyl-2-(4-chloro-2-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 60721606 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-butyl-2-(4-chloro-2-fluoroanilino)propanamide |
| SMILES | CCCCNC(=O)C(C)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H18ClFN2O/c1-3-4-7-16-13(18)9(2)17-12-6-5-10(14)8-11(12)15/h5-6,8-9,17H,3-4,7H2,1-2H3,(H,16,18) |
| InChIKey | QBRQQALIGHAMLB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|