C10H10Cl2N2O3 — CID 78843041
N'-(2,4-dichlorophenyl)-N-(2-hydroxyethyl)oxamide (PubChem CID 78843041) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-(2,4-dichlorophenyl)-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 78843041 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-N-(2-hydroxyethyl)oxamide |
| SMILES | O=C(NCCO)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O3/c11-6-1-2-8(7(12)5-6)14-10(17)9(16)13-3-4-15/h1-2,5,15H,3-4H2,(H,13,16)(H,14,17) |
| InChIKey | KECVRQSRPIQBRF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|