C14H16Cl2N2O3 — CID 111490962
N'-(2,4-dichlorophenyl)-N-[(2-hydroxycyclopentyl)methyl]oxamide (PubChem CID 111490962) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-N-[(2-hydroxycyclopentyl)methyl]oxamide.
| Compound Name | N'-(2,4-dichlorophenyl)-N-[(2-hydroxycyclopentyl)methyl]oxamide |
|---|---|
| PubChem CID | 111490962 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-N-[(2-hydroxycyclopentyl)methyl]oxamide |
| SMILES | O=C(NCC1CCCC1O)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-9-4-5-11(10(16)6-9)18-14(21)13(20)17-7-8-2-1-3-12(8)19/h4-6,8,12,19H,1-3,7H2,(H,17,20)(H,18,21) |
| InChIKey | WJCHGOPJZBBXFV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|