C13H15FN4O2 — CID 91763037
2-(3-fluorophenyl)-2-hydroxy-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide (PubChem CID 91763037) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-hydroxy-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-2-hydroxy-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 91763037 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-(3-fluorophenyl)-2-hydroxy-N-[3-(1,2,4-triazol-1-yl)propyl]acetamide |
| SMILES | O=C(NCCCn1cncn1)C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN4O2/c14-11-4-1-3-10(7-11)12(19)13(20)16-5-2-6-18-9-15-8-17-18/h1,3-4,7-9,12,19H,2,5-6H2,(H,16,20) |
| InChIKey | DVIRSKXBTQHFTD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|