C15H20FN5O2 — CID 94168500
1-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea (PubChem CID 94168500) has the molecular formula C15H20FN5O2 and a molecular weight of 321.36 g/mol. Its IUPAC name is 1-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea.
| Compound Name | 1-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 94168500 |
| Molecular Formula | C15H20FN5O2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
| SMILES | COc1ccc([C@@H](C)NC(=O)NCCCn2cncn2)cc1F |
| InChI | InChI=1S/C15H20FN5O2/c1-11(12-4-5-14(23-2)13(16)8-12)20-15(22)18-6-3-7-21-10-17-9-19-21/h4-5,8-11H,3,6-7H2,1-2H3,(H2,18,20,22)/t11-/m1/s1 |
| InChIKey | HYXXSYKCCBGQTD-LLVKDONJSA-N |
| XLogP | 1.88 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|