C15H21F2N3O3 — CID 119051460
N-(2-fluoroethyl)-2-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoylamino]propanamide (PubChem CID 119051460) has the molecular formula C15H21F2N3O3 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoylamino]propanamide.
| Compound Name | N-(2-fluoroethyl)-2-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 119051460 |
| Molecular Formula | C15H21F2N3O3 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-(2-fluoroethyl)-2-[1-(3-fluoro-4-methoxyphenyl)ethylcarbamoylamino]propanamide |
| SMILES | COc1ccc(C(C)NC(=O)NC(C)C(=O)NCCF)cc1F |
| InChI | InChI=1S/C15H21F2N3O3/c1-9(11-4-5-13(23-3)12(17)8-11)19-15(22)20-10(2)14(21)18-7-6-16/h4-5,8-10H,6-7H2,1-3H3,(H,18,21)(H2,19,20,22) |
| InChIKey | FCBUWCRREZYBHL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |