C13H18FNO4S — CID 94024950
(2R)-N-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylsulfonylpropanamide (PubChem CID 94024950) has the molecular formula C13H18FNO4S and a molecular weight of 303.36 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 94024950 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2R)-N-[(1R)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylsulfonylpropanamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)[C@@H](C)S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C13H18FNO4S/c1-8(15-13(16)9(2)20(4,17)18)10-5-6-12(19-3)11(14)7-10/h5-9H,1-4H3,(H,15,16)/t8-,9-/m1/s1 |
| InChIKey | XLARYDJEYBSXFS-RKDXNWHRSA-N |
| XLogP | 1.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |