C23H22FNO2 — CID 9051417
N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2,2-diphenylacetamide (PubChem CID 9051417) has the molecular formula C23H22FNO2 and a molecular weight of 363.43 g/mol. Its IUPAC name is N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 9051417 |
| Molecular Formula | C23H22FNO2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc([C@H](C)NC(=O)C(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C23H22FNO2/c1-16(19-13-14-21(27-2)20(24)15-19)25-23(26)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16,22H,1-2H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | JUXVXRATXHDTHE-INIZCTEOSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |