C26H29NO3 — CID 46440384
N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-2,2-diphenylacetamide (PubChem CID 46440384) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 46440384 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-2,2-diphenylacetamide |
| SMILES | COc1cc(C(C)NC(=O)C(c2ccccc2)c2ccccc2)ccc1OC(C)C |
| InChI | InChI=1S/C26H29NO3/c1-18(2)30-23-16-15-22(17-24(23)29-4)19(3)27-26(28)25(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-19,25H,1-4H3,(H,27,28) |
| InChIKey | FWQMCLABLQANEQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |