C14H18ClN5O — CID 94157536
1-[(1R)-1-(2-chlorophenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea (PubChem CID 94157536) has the molecular formula C14H18ClN5O and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-[(1R)-1-(2-chlorophenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea.
| Compound Name | 1-[(1R)-1-(2-chlorophenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 94157536 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[(1R)-1-(2-chlorophenyl)ethyl]-3-[3-(1,2,4-triazol-1-yl)propyl]urea |
| SMILES | C[C@@H](NC(=O)NCCCn1cncn1)c1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN5O/c1-11(12-5-2-3-6-13(12)15)19-14(21)17-7-4-8-20-10-16-9-18-20/h2-3,5-6,9-11H,4,7-8H2,1H3,(H2,17,19,21)/t11-/m1/s1 |
| InChIKey | IYDSZFRNLCIOQH-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|