C13H18ClN3O2 — CID 94157556
4-[[(1R)-1-(2-chlorophenyl)ethyl]carbamoylamino]butanamide (PubChem CID 94157556) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-[[(1R)-1-(2-chlorophenyl)ethyl]carbamoylamino]butanamide.
| Compound Name | 4-[[(1R)-1-(2-chlorophenyl)ethyl]carbamoylamino]butanamide |
|---|---|
| PubChem CID | 94157556 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[[(1R)-1-(2-chlorophenyl)ethyl]carbamoylamino]butanamide |
| SMILES | C[C@@H](NC(=O)NCCCC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClN3O2/c1-9(10-5-2-3-6-11(10)14)17-13(19)16-8-4-7-12(15)18/h2-3,5-6,9H,4,7-8H2,1H3,(H2,15,18)(H2,16,17,19)/t9-/m1/s1 |
| InChIKey | MKBLMPQDWUTUKR-SECBINFHSA-N |
| XLogP | 1.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|