C12H12F2N4O — CID 86822852
N-(3,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 86822852) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-(3,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 86822852 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | O=C(CCCn1cncn1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12F2N4O/c13-10-4-3-9(6-11(10)14)17-12(19)2-1-5-18-8-15-7-16-18/h3-4,6-8H,1-2,5H2,(H,17,19) |
| InChIKey | QLYLPXZIECKIMO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |