C13H15FN4O2 — CID 79199960
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-hydroxypentanamide (PubChem CID 79199960) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-hydroxypentanamide.
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-hydroxypentanamide |
|---|---|
| PubChem CID | 79199960 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-5-hydroxypentanamide |
| SMILES | O=C(CCCCO)Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C13H15FN4O2/c14-11-7-10(17-13(20)3-1-2-6-19)4-5-12(11)18-9-15-8-16-18/h4-5,7-9,19H,1-3,6H2,(H,17,20) |
| InChIKey | FUKMAVZBBNGYOS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|