C12H12BrFN4O — CID 114328059
2-bromo-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide (PubChem CID 114328059) has the molecular formula C12H12BrFN4O and a molecular weight of 327.16 g/mol. Its IUPAC name is 2-bromo-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 114328059 |
| Molecular Formula | C12H12BrFN4O |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-bromo-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C12H12BrFN4O/c1-12(2,13)11(19)17-8-3-4-10(9(14)5-8)18-7-15-6-16-18/h3-7H,1-2H3,(H,17,19) |
| InChIKey | SOVMWZILKMOZRL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|