C12H12ClFN4O — CID 62726630
3-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide (PubChem CID 62726630) has the molecular formula C12H12ClFN4O and a molecular weight of 282.71 g/mol. Its IUPAC name is 3-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide.
| Compound Name | 3-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 62726630 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C12H12ClFN4O/c1-8(5-13)12(19)17-9-2-3-11(10(14)4-9)18-7-15-6-16-18/h2-4,6-8H,5H2,1H3,(H,17,19) |
| InChIKey | FDJNYUABOURDTF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|