C10H8ClFN4O — CID 60809987
2-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide (PubChem CID 60809987) has the molecular formula C10H8ClFN4O and a molecular weight of 254.65 g/mol. Its IUPAC name is 2-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 60809987 |
| Molecular Formula | C10H8ClFN4O |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-chloro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C10H8ClFN4O/c11-4-10(17)15-7-1-2-9(8(12)3-7)16-6-13-5-14-16/h1-3,5-6H,4H2,(H,15,17) |
| InChIKey | FCGUDVKAYOMGIN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|