C15H8Cl2F2N4O — CID 47049176
2,4-dichloro-5-fluoro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 47049176) has the molecular formula C15H8Cl2F2N4O and a molecular weight of 369.16 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 47049176 |
| Molecular Formula | C15H8Cl2F2N4O |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)c(F)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl2F2N4O/c16-10-5-11(17)12(18)4-9(10)15(24)22-8-1-2-14(13(19)3-8)23-7-20-6-21-23/h1-7H,(H,22,24) |
| InChIKey | SLEJCQPPTGUWLA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|