C18H14Cl2FN5O2 — CID 46439736
2,4-dichloro-5-fluoro-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]benzamide (PubChem CID 46439736) has the molecular formula C18H14Cl2FN5O2 and a molecular weight of 422.25 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 46439736 |
| Molecular Formula | C18H14Cl2FN5O2 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]benzamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)c2cc(F)c(Cl)cc2Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C18H14Cl2FN5O2/c1-10(26-9-22-8-23-26)17(27)24-11-2-4-12(5-3-11)25-18(28)13-6-16(21)15(20)7-14(13)19/h2-10H,1H3,(H,24,27)(H,25,28) |
| InChIKey | CMOOHGDBWRNBAZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|