C13H13ClFN5O2 — CID 166427685
N-[4-[(2-chloro-2-fluoroacetyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 166427685) has the molecular formula C13H13ClFN5O2 and a molecular weight of 325.73 g/mol. Its IUPAC name is N-[4-[(2-chloro-2-fluoroacetyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[4-[(2-chloro-2-fluoroacetyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 166427685 |
| Molecular Formula | C13H13ClFN5O2 |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[4-[(2-chloro-2-fluoroacetyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)C(F)Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C13H13ClFN5O2/c1-8(20-7-16-6-17-20)12(21)18-9-2-4-10(5-3-9)19-13(22)11(14)15/h2-8,11H,1H3,(H,18,21)(H,19,22) |
| InChIKey | ONXXEOOSAYSEFH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|