C21H26N4O — CID 37072589
(2R)-N-[4-(1-adamantyl)phenyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 37072589) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is (2R)-N-[4-(1-adamantyl)phenyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | (2R)-N-[4-(1-adamantyl)phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 37072589 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2R)-N-[4-(1-adamantyl)phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)n1cncn1 |
| InChI | InChI=1S/C21H26N4O/c1-14(25-13-22-12-23-25)20(26)24-19-4-2-18(3-5-19)21-9-15-6-16(10-21)8-17(7-15)11-21/h2-5,12-17H,6-11H2,1H3,(H,24,26)/t14-,15?,16?,17?,21?/m1/s1 |
| InChIKey | SBEJNFBVBBDSBI-LFPRZYRFSA-N |
| XLogP | 3.95 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |