C16H17Cl2N5O2 — CID 43071026
2,2-dichloro-1-methyl-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclopropane-1-carboxamide (PubChem CID 43071026) has the molecular formula C16H17Cl2N5O2 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43071026 |
| Molecular Formula | C16H17Cl2N5O2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclopropane-1-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)C2(C)CC2(Cl)Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C16H17Cl2N5O2/c1-10(23-9-19-8-20-23)13(24)21-11-3-5-12(6-4-11)22-14(25)15(2)7-16(15,17)18/h3-6,8-10H,7H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | WHWCSXXKUDHQPK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|