C18H21N5O2 — CID 43064378
N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 43064378) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 43064378 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)C2CC=CCC2)cc1)n1cncn1 |
| InChI | InChI=1S/C18H21N5O2/c1-13(23-12-19-11-20-23)17(24)21-15-7-9-16(10-8-15)22-18(25)14-5-3-2-4-6-14/h2-3,7-14H,4-6H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | HMSBAGFXVCRPAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|