C26H28N6O3 — CID 43064665
1-[(E)-3-phenylprop-2-enoyl]-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]piperidine-4-carboxamide (PubChem CID 43064665) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-[(E)-3-phenylprop-2-enoyl]-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-phenylprop-2-enoyl]-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43064665 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-[(E)-3-phenylprop-2-enoyl]-N-[4-[2-(1,2,4-triazol-1-yl)propanoylamino]phenyl]piperidine-4-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(NC(=O)C2CCN(C(=O)/C=C/c3ccccc3)CC2)cc1)n1cncn1 |
| InChI | InChI=1S/C26H28N6O3/c1-19(32-18-27-17-28-32)25(34)29-22-8-10-23(11-9-22)30-26(35)21-13-15-31(16-14-21)24(33)12-7-20-5-3-2-4-6-20/h2-12,17-19,21H,13-16H2,1H3,(H,29,34)(H,30,35)/b12-7+ |
| InChIKey | RNYWOYDQVCMWJI-KPKJPENVSA-N |
| XLogP | 3.37 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|