C17H14Cl2F2N2O — CID 52701753
2,4-dichloro-5-fluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 52701753) has the molecular formula C17H14Cl2F2N2O and a molecular weight of 371.21 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 52701753 |
| Molecular Formula | C17H14Cl2F2N2O |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(F)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2F2N2O/c18-12-9-13(19)14(20)8-11(12)17(24)22-10-3-4-16(15(21)7-10)23-5-1-2-6-23/h3-4,7-9H,1-2,5-6H2,(H,22,24) |
| InChIKey | ABZGDPLNIQXWFA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|