C13H13FN4OS — CID 47311910
N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 47311910) has the molecular formula C13H13FN4OS and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 47311910 |
| Molecular Formula | C13H13FN4OS |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(F)c1)c1cnsn1 |
| InChI | InChI=1S/C13H13FN4OS/c14-10-7-9(16-13(19)11-8-15-20-17-11)3-4-12(10)18-5-1-2-6-18/h3-4,7-8H,1-2,5-6H2,(H,16,19) |
| InChIKey | JZYKAJGCSIWCOI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|