C15H14BrFN2OS — CID 61062659
3-bromo-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophene-2-carboxamide (PubChem CID 61062659) has the molecular formula C15H14BrFN2OS and a molecular weight of 369.26 g/mol. Its IUPAC name is 3-bromo-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61062659 |
| Molecular Formula | C15H14BrFN2OS |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 3-bromo-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(F)c1)c1sccc1Br |
| InChI | InChI=1S/C15H14BrFN2OS/c16-11-5-8-21-14(11)15(20)18-10-3-4-13(12(17)9-10)19-6-1-2-7-19/h3-5,8-9H,1-2,6-7H2,(H,18,20) |
| InChIKey | WVBSCQRRKBJNRR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|