C17H17Cl2N3O — CID 91676429
N-(3-amino-4-pyrrolidin-1-ylphenyl)-2,4-dichlorobenzamide (PubChem CID 91676429) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is N-(3-amino-4-pyrrolidin-1-ylphenyl)-2,4-dichlorobenzamide.
| Compound Name | N-(3-amino-4-pyrrolidin-1-ylphenyl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 91676429 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-(3-amino-4-pyrrolidin-1-ylphenyl)-2,4-dichlorobenzamide |
| SMILES | Nc1cc(NC(=O)c2ccc(Cl)cc2Cl)ccc1N1CCCC1 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-11-3-5-13(14(19)9-11)17(23)21-12-4-6-16(15(20)10-12)22-7-1-2-8-22/h3-6,9-10H,1-2,7-8,20H2,(H,21,23) |
| InChIKey | USVVAHJCCRZGJO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|