C19H23ClN4O — CID 91676128
N-[3-amino-4-(4-ethylpiperazin-1-yl)phenyl]-2-chlorobenzamide (PubChem CID 91676128) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[3-amino-4-(4-ethylpiperazin-1-yl)phenyl]-2-chlorobenzamide.
| Compound Name | N-[3-amino-4-(4-ethylpiperazin-1-yl)phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 91676128 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[3-amino-4-(4-ethylpiperazin-1-yl)phenyl]-2-chlorobenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccccc3Cl)cc2N)CC1 |
| InChI | InChI=1S/C19H23ClN4O/c1-2-23-9-11-24(12-10-23)18-8-7-14(13-17(18)21)22-19(25)15-5-3-4-6-16(15)20/h3-8,13H,2,9-12,21H2,1H3,(H,22,25) |
| InChIKey | VGKKCJIQEXBQSH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|