C18H15Cl2F3N2O — CID 1397318
2,4-dichloro-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 1397318) has the molecular formula C18H15Cl2F3N2O and a molecular weight of 403.23 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1397318 |
| Molecular Formula | C18H15Cl2F3N2O |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2,4-dichloro-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2F3N2O/c19-12-4-5-13(14(20)10-12)17(26)24-15-9-11(18(21,22)23)3-6-16(15)25-7-1-2-8-25/h3-6,9-10H,1-2,7-8H2,(H,24,26) |
| InChIKey | IVUIFFDSQOKGIF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |