C16H15F3N2OS — CID 953308
N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 953308) has the molecular formula C16H15F3N2OS and a molecular weight of 340.37 g/mol. Its IUPAC name is N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 953308 |
| Molecular Formula | C16H15F3N2OS |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1cccs1 |
| InChI | InChI=1S/C16H15F3N2OS/c17-16(18,19)11-5-6-13(21-7-1-2-8-21)12(10-11)20-15(22)14-4-3-9-23-14/h3-6,9-10H,1-2,7-8H2,(H,20,22) |
| InChIKey | CZZNQFKVQYGREB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |