C17H18F3N3O3S2 — CID 55677816
N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 55677816) has the molecular formula C17H18F3N3O3S2 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 55677816 |
| Molecular Formula | C17H18F3N3O3S2 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C17H18F3N3O3S2/c18-17(19,20)12-5-6-14(23-7-1-2-8-23)13(10-12)22-15(24)11-21-28(25,26)16-4-3-9-27-16/h3-6,9-10,21H,1-2,7-8,11H2,(H,22,24) |
| InChIKey | UQRLTVCMHUUDQO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |