C19H17BrF4N2O — CID 146025161
2-(3-bromo-2-fluorophenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 146025161) has the molecular formula C19H17BrF4N2O and a molecular weight of 445.25 g/mol. Its IUPAC name is 2-(3-bromo-2-fluorophenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-bromo-2-fluorophenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 146025161 |
| Molecular Formula | C19H17BrF4N2O |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 2-(3-bromo-2-fluorophenyl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(Br)c1F)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C19H17BrF4N2O/c20-14-5-3-4-12(18(14)21)10-17(27)25-15-11-13(19(22,23)24)6-7-16(15)26-8-1-2-9-26/h3-7,11H,1-2,8-10H2,(H,25,27) |
| InChIKey | ZGTOVQYHFREWSW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |