C20H21F4N3O — CID 24615057
N-(5-fluoro-2-methylphenyl)-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]acetamide (PubChem CID 24615057) has the molecular formula C20H21F4N3O and a molecular weight of 395.40 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 24615057 |
| Molecular Formula | C20H21F4N3O |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CNc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C20H21F4N3O/c1-13-4-6-15(21)11-16(13)26-19(28)12-25-17-10-14(20(22,23)24)5-7-18(17)27-8-2-3-9-27/h4-7,10-11,25H,2-3,8-9,12H2,1H3,(H,26,28) |
| InChIKey | JVFKRMWUJRSCRJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |