C6H11N5O — CID 63572043
4-(1,2,4-triazol-1-yl)butanehydrazide (PubChem CID 63572043) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-yl)butanehydrazide.
| Compound Name | 4-(1,2,4-triazol-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 63572043 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 4-(1,2,4-triazol-1-yl)butanehydrazide |
| SMILES | NNC(=O)CCCn1cncn1 |
| InChI | InChI=1S/C6H11N5O/c7-10-6(12)2-1-3-11-5-8-4-9-11/h4-5H,1-3,7H2,(H,10,12) |
| InChIKey | SFDJRKWPNUOUBU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|