C14H24N4O2 — CID 154565061
N-[(1S,2S)-2-hydroxycyclooctyl]-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 154565061) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclooctyl]-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclooctyl]-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 154565061 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclooctyl]-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | O=C(CCCn1cncn1)N[C@H]1CCCCCC[C@@H]1O |
| InChI | InChI=1S/C14H24N4O2/c19-13-7-4-2-1-3-6-12(13)17-14(20)8-5-9-18-11-15-10-16-18/h10-13,19H,1-9H2,(H,17,20)/t12-,13-/m0/s1 |
| InChIKey | GZJTZSCSIOAGAU-STQMWFEESA-N |
| XLogP | 1.26 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |