C18H32N2O4 — CID 40600214
N-[(1R,2S)-2-hydroxycyclohexyl]-N'-[(1S,2R)-2-hydroxycyclohexyl]hexanediamide (PubChem CID 40600214) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxycyclohexyl]-N'-[(1S,2R)-2-hydroxycyclohexyl]hexanediamide.
| Compound Name | N-[(1R,2S)-2-hydroxycyclohexyl]-N'-[(1S,2R)-2-hydroxycyclohexyl]hexanediamide |
|---|---|
| PubChem CID | 40600214 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N-[(1R,2S)-2-hydroxycyclohexyl]-N'-[(1S,2R)-2-hydroxycyclohexyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)N[C@@H]1CCCC[C@@H]1O)N[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C18H32N2O4/c21-15-9-3-1-7-13(15)19-17(23)11-5-6-12-18(24)20-14-8-2-4-10-16(14)22/h13-16,21-22H,1-12H2,(H,19,23)(H,20,24)/t13-,14+,15+,16- |
| InChIKey | SJGRLYPQEVOQDD-SYMSYNOKSA-N |
| XLogP | 1.39 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|