C12H24N2O2 — CID 107221663
6-amino-N-[(1S,2S)-2-hydroxycyclohexyl]hexanamide (PubChem CID 107221663) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 6-amino-N-[(1S,2S)-2-hydroxycyclohexyl]hexanamide.
| Compound Name | 6-amino-N-[(1S,2S)-2-hydroxycyclohexyl]hexanamide |
|---|---|
| PubChem CID | 107221663 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 6-amino-N-[(1S,2S)-2-hydroxycyclohexyl]hexanamide |
| SMILES | NCCCCCC(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H24N2O2/c13-9-5-1-2-8-12(16)14-10-6-3-4-7-11(10)15/h10-11,15H,1-9,13H2,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | OMTKCJPBODJXGF-QWRGUYRKSA-N |
| XLogP | 0.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|