C10H18ClNO2 — CID 107216783
4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]butanamide (PubChem CID 107216783) has the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]butanamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]butanamide |
|---|---|
| PubChem CID | 107216783 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]butanamide |
| SMILES | O=C(CCCCl)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H18ClNO2/c11-7-3-6-10(14)12-8-4-1-2-5-9(8)13/h8-9,13H,1-7H2,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | HSSYPPODRHCVAA-RKDXNWHRSA-N |
| XLogP | 1.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|