C12H20N4O3 — CID 91770644
N-[(3S,4R)-3-methoxyoxan-4-yl]-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 91770644) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(3S,4R)-3-methoxyoxan-4-yl]-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-[(3S,4R)-3-methoxyoxan-4-yl]-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 91770644 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-[(3S,4R)-3-methoxyoxan-4-yl]-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)CCCn1cncn1 |
| InChI | InChI=1S/C12H20N4O3/c1-18-11-7-19-6-4-10(11)15-12(17)3-2-5-16-9-13-8-14-16/h8-11H,2-7H2,1H3,(H,15,17)/t10-,11-/m1/s1 |
| InChIKey | RVWNYRWGRSPBOT-GHMZBOCLSA-N |
| XLogP | -0.02 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |