C21H28N4O2 — CID 92596564
N-[(1R,6S,7S,8R)-8-(4-methoxyphenyl)-7-bicyclo[4.2.0]octanyl]-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 92596564) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[(1R,6S,7S,8R)-8-(4-methoxyphenyl)-7-bicyclo[4.2.0]octanyl]-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-[(1R,6S,7S,8R)-8-(4-methoxyphenyl)-7-bicyclo[4.2.0]octanyl]-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 92596564 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[(1R,6S,7S,8R)-8-(4-methoxyphenyl)-7-bicyclo[4.2.0]octanyl]-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@@H]3[C@@H]2NC(=O)CCCn2cncn2)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-27-16-10-8-15(9-11-16)20-17-5-2-3-6-18(17)21(20)24-19(26)7-4-12-25-14-22-13-23-25/h8-11,13-14,17-18,20-21H,2-7,12H2,1H3,(H,24,26)/t17-,18+,20+,21+/m1/s1 |
| InChIKey | SZFNOUNOEZWEIX-ZFMNYDKASA-N |
| XLogP | 3.16 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |