C12H19N3O3 — CID 91797838
N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-pyrazol-1-ylbutanamide (PubChem CID 91797838) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-pyrazol-1-ylbutanamide.
| Compound Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 91797838 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-pyrazol-1-ylbutanamide |
| SMILES | O=C(CCCn1cccn1)N[C@@H]1COCC[C@H]1O |
| InChI | InChI=1S/C12H19N3O3/c16-11-4-8-18-9-10(11)14-12(17)3-1-6-15-7-2-5-13-15/h2,5,7,10-11,16H,1,3-4,6,8-9H2,(H,14,17)/t10-,11-/m1/s1 |
| InChIKey | KWHCYBMJXPACIL-GHMZBOCLSA-N |
| XLogP | -0.07 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |