C16H23NO4 — CID 91797072
N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-(4-methoxyphenyl)butanamide (PubChem CID 91797072) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 91797072 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-4-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)N[C@@H]2COCC[C@H]2O)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-20-13-7-5-12(6-8-13)3-2-4-16(19)17-14-11-21-10-9-15(14)18/h5-8,14-15,18H,2-4,9-11H2,1H3,(H,17,19)/t14-,15-/m1/s1 |
| InChIKey | NNJTZXAOSMPXDV-HUUCEWRRSA-N |
| XLogP | 1.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |