C15H20FNO3 — CID 91763561
4-(4-fluorophenyl)-N-[(3S,4R)-3-hydroxyoxan-4-yl]butanamide (PubChem CID 91763561) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(3S,4R)-3-hydroxyoxan-4-yl]butanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[(3S,4R)-3-hydroxyoxan-4-yl]butanamide |
|---|---|
| PubChem CID | 91763561 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(3S,4R)-3-hydroxyoxan-4-yl]butanamide |
| SMILES | O=C(CCCc1ccc(F)cc1)N[C@@H]1CCOC[C@H]1O |
| InChI | InChI=1S/C15H20FNO3/c16-12-6-4-11(5-7-12)2-1-3-15(19)17-13-8-9-20-10-14(13)18/h4-7,13-14,18H,1-3,8-10H2,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | XHULDJYOOXKKAN-ZIAGYGMSSA-N |
| XLogP | 1.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |