C16H22FNO3 — CID 110125855
N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-3-(4-fluorophenyl)propanamide (PubChem CID 110125855) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 110125855 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-3-(4-fluorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(F)cc1)N[C@@H]1CCCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H22FNO3/c17-12-8-5-11(6-9-12)7-10-15(20)18-13-3-1-2-4-14(19)16(13)21/h5-6,8-9,13-14,16,19,21H,1-4,7,10H2,(H,18,20)/t13-,14-,16-/m1/s1 |
| InChIKey | ARYCJYQGMASZDK-IIAWOOMASA-N |
| XLogP | 1.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |