C14H19FN2O2 — CID 94797733
1-[(4-fluorophenyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]urea (PubChem CID 94797733) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]urea |
|---|---|
| PubChem CID | 94797733 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H19FN2O2/c15-11-7-5-10(6-8-11)9-16-14(19)17-12-3-1-2-4-13(12)18/h5-8,12-13,18H,1-4,9H2,(H2,16,17,19)/t12-,13-/m0/s1 |
| InChIKey | CSQSRDVRZYUFRG-STQMWFEESA-N |
| XLogP | 1.93 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |